C46H90NO10P — CID 87081911
(2S)-2-amino-3-[[(2R)-2,3-bis(3,7,11,15-tetramethylhexadecanoyloxy)propoxy]-hydroxyphosphoryl]oxypropanoic acid (PubChem CID 87081911) has the molecular formula C46H90NO10P and a molecular weight of 848.20 g/mol. Its IUPAC name is (2S)-2-amino-3-[[(2R)-2,3-bis(3,7,11,15-tetramethylhexadecanoyloxy)propoxy]-hydroxyphosphoryl]oxypropanoic acid.
| Compound Name | (2S)-2-amino-3-[[(2R)-2,3-bis(3,7,11,15-tetramethylhexadecanoyloxy)propoxy]-hydroxyphosphoryl]oxypropanoic acid |
|---|---|
| PubChem CID | 87081911 |
| Molecular Formula | C46H90NO10P |
| Molecular Weight | 848.20 g/mol |
| Exact Mass | 847.63 |
| IUPAC Name | (2S)-2-amino-3-[[(2R)-2,3-bis(3,7,11,15-tetramethylhexadecanoyloxy)propoxy]-hydroxyphosphoryl]oxypropanoic acid |
| SMILES | CC(C)CCCC(C)CCCC(C)CCCC(C)CC(=O)OC[C@H](COP(=O)(O)OC[C@H](N)C(=O)O)OC(=O)CC(C)CCCC(C)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C46H90NO10P/c1-34(2)17-11-19-36(5)21-13-23-38(7)25-15-27-40(9)29-44(48)54-31-42(32-55-58(52,53)56-33-43(47)46(50)51)57-45(49)30-41(10)28-16-26-39(8)24-14-22-37(6)20-12-18-35(3)4/h34-43H,11-33,47H2,1-10H3,(H,50,51)(H,52,53)/t36?,37?,38?,39?,40?,41?,42-,43+/m1/s1 |
| InChIKey | IIXIIBIZLZWEBO-VBDDYPLXSA-N |
| XLogP | 11.92 |
| TPSA | 171.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 848.20 |
| LogP ≤ 5 | 11.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|