C46H94NO8P — CID 72734314
(2S)-2-amino-3-[[(2S)-2,3-bis(3,7,11,15-tetramethylhexadecoxy)propoxy]-hydroxyphosphoryl]oxypropanoic acid (PubChem CID 72734314) has the molecular formula C46H94NO8P and a molecular weight of 820.23 g/mol. Its IUPAC name is (2S)-2-amino-3-[[(2S)-2,3-bis(3,7,11,15-tetramethylhexadecoxy)propoxy]-hydroxyphosphoryl]oxypropanoic acid.
| Compound Name | (2S)-2-amino-3-[[(2S)-2,3-bis(3,7,11,15-tetramethylhexadecoxy)propoxy]-hydroxyphosphoryl]oxypropanoic acid |
|---|---|
| PubChem CID | 72734314 |
| Molecular Formula | C46H94NO8P |
| Molecular Weight | 820.23 g/mol |
| Exact Mass | 819.67 |
| IUPAC Name | (2S)-2-amino-3-[[(2S)-2,3-bis(3,7,11,15-tetramethylhexadecoxy)propoxy]-hydroxyphosphoryl]oxypropanoic acid |
| SMILES | CC(C)CCCC(C)CCCC(C)CCCC(C)CCOC[C@@H](COP(=O)(O)OC[C@H](N)C(=O)O)OCCC(C)CCCC(C)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C46H94NO8P/c1-36(2)17-11-19-38(5)21-13-23-40(7)25-15-27-42(9)29-31-52-33-44(34-54-56(50,51)55-35-45(47)46(48)49)53-32-30-43(10)28-16-26-41(8)24-14-22-39(6)20-12-18-37(3)4/h36-45H,11-35,47H2,1-10H3,(H,48,49)(H,50,51)/t38?,39?,40?,41?,42?,43?,44-,45-/m0/s1 |
| InChIKey | REWAKYJADCBFMU-CIFIPRASSA-N |
| XLogP | 12.86 |
| TPSA | 137.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 820.23 |
| LogP ≤ 5 | 12.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|