C46H94NO9P — CID 126961239
(2S)-2-amino-3-[hydroxy-[(2S)-2-[(3R,7R,11R)-3-hydroxy-3,7,11,15-tetramethylhexadecoxy]-3-[(3R,7R,11R)-3,7,11,15-tetramethylhexadecoxy]propoxy]phosphoryl]oxypropanoic acid (PubChem CID 126961239) has the molecular formula C46H94NO9P and a molecular weight of 836.23 g/mol. Its IUPAC name is (2S)-2-amino-3-[hydroxy-[(2S)-2-[(3R,7R,11R)-3-hydroxy-3,7,11,15-tetramethylhexadecoxy]-3-[(3R,7R,11R)-3,7,11,15-tetramethylhexadecoxy]propoxy]phosphoryl]oxypropanoic acid.
| Compound Name | (2S)-2-amino-3-[hydroxy-[(2S)-2-[(3R,7R,11R)-3-hydroxy-3,7,11,15-tetramethylhexadecoxy]-3-[(3R,7R,11R)-3,7,11,15-tetramethylhexadecoxy]propoxy]phosphoryl]oxypropanoic acid |
|---|---|
| PubChem CID | 126961239 |
| Molecular Formula | C46H94NO9P |
| Molecular Weight | 836.23 g/mol |
| Exact Mass | 835.67 |
| IUPAC Name | (2S)-2-amino-3-[hydroxy-[(2S)-2-[(3R,7R,11R)-3-hydroxy-3,7,11,15-tetramethylhexadecoxy]-3-[(3R,7R,11R)-3,7,11,15-tetramethylhexadecoxy]propoxy]phosphoryl]oxypropanoic acid |
| SMILES | CC(C)CCC[C@@H](C)CCC[C@@H](C)CCC[C@@H](C)CCOC[C@@H](COP(=O)(O)OC[C@H](N)C(=O)O)OCC[C@](C)(O)CCC[C@H](C)CCC[C@H](C)CCCC(C)C |
| InChI | InChI=1S/C46H94NO9P/c1-36(2)17-11-19-38(5)21-13-23-40(7)24-15-26-42(9)28-31-53-33-43(34-55-57(51,52)56-35-44(47)45(48)49)54-32-30-46(10,50)29-16-27-41(8)25-14-22-39(6)20-12-18-37(3)4/h36-44,50H,11-35,47H2,1-10H3,(H,48,49)(H,51,52)/t38-,39-,40-,41-,42-,43+,44+,46-/m1/s1 |
| InChIKey | YALRQOMGANIIQK-QQLPJPLTSA-N |
| XLogP | 11.98 |
| TPSA | 157.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 836.23 |
| LogP ≤ 5 | 11.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|