C46H94O9P- — CID 126961139
[(2R)-2,3-dihydroxypropyl] [(2S)-2-[(3R,7R,11R)-3-hydroxy-3,7,11,15-tetramethylhexadecoxy]-3-[(3R,7R,11R)-3,7,11,15-tetramethylhexadecoxy]propyl] phosphate (PubChem CID 126961139) has the molecular formula C46H94O9P- and a molecular weight of 822.22 g/mol. Its IUPAC name is [(2R)-2,3-dihydroxypropyl] [(2S)-2-[(3R,7R,11R)-3-hydroxy-3,7,11,15-tetramethylhexadecoxy]-3-[(3R,7R,11R)-3,7,11,15-tetramethylhexadecoxy]propyl] phosphate.
| Compound Name | [(2R)-2,3-dihydroxypropyl] [(2S)-2-[(3R,7R,11R)-3-hydroxy-3,7,11,15-tetramethylhexadecoxy]-3-[(3R,7R,11R)-3,7,11,15-tetramethylhexadecoxy]propyl] phosphate |
|---|---|
| PubChem CID | 126961139 |
| Molecular Formula | C46H94O9P- |
| Molecular Weight | 822.22 g/mol |
| Exact Mass | 821.66 |
| IUPAC Name | [(2R)-2,3-dihydroxypropyl] [(2S)-2-[(3R,7R,11R)-3-hydroxy-3,7,11,15-tetramethylhexadecoxy]-3-[(3R,7R,11R)-3,7,11,15-tetramethylhexadecoxy]propyl] phosphate |
| SMILES | CC(C)CCC[C@@H](C)CCC[C@@H](C)CCC[C@@H](C)CCOC[C@@H](COP(=O)([O-])OC[C@H](O)CO)OCC[C@](C)(O)CCC[C@H](C)CCC[C@H](C)CCCC(C)C |
| InChI | InChI=1S/C46H95O9P/c1-37(2)17-11-19-39(5)21-13-23-41(7)24-15-26-43(9)28-31-52-35-45(36-55-56(50,51)54-34-44(48)33-47)53-32-30-46(10,49)29-16-27-42(8)25-14-22-40(6)20-12-18-38(3)4/h37-45,47-49H,11-36H2,1-10H3,(H,50,51)/p-1/t39-,40-,41-,42-,43-,44-,45+,46-/m1/s1 |
| InChIKey | BIVFMXPCWMONSY-XHQCNPPWSA-M |
| XLogP | 11.29 |
| TPSA | 137.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 822.22 |
| LogP ≤ 5 | 11.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|