C17H32NO9P — CID 88672360
[2-(3-carboxyprop-2-enoyloxy)-3-pentoxypropyl] 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 88672360) has the molecular formula C17H32NO9P and a molecular weight of 425.42 g/mol. Its IUPAC name is [2-(3-carboxyprop-2-enoyloxy)-3-pentoxypropyl] 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | [2-(3-carboxyprop-2-enoyloxy)-3-pentoxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 88672360 |
| Molecular Formula | C17H32NO9P |
| Molecular Weight | 425.42 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | [2-(3-carboxyprop-2-enoyloxy)-3-pentoxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | CCCCCOCC(COP(=O)([O-])OCC[N+](C)(C)C)OC(=O)C=CC(=O)O |
| InChI | InChI=1S/C17H32NO9P/c1-5-6-7-11-24-13-15(27-17(21)9-8-16(19)20)14-26-28(22,23)25-12-10-18(2,3)4/h8-9,15H,5-7,10-14H2,1-4H3,(H-,19,20,22,23) |
| InChIKey | NRFZFBVKAJQOEQ-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 131.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.42 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|