C22H33NO6P+ — CID 175436489
2-[2,3-bis(2-methylphenoxy)propoxy-hydroxyphosphoryl]oxyethyl-trimethylazanium (PubChem CID 175436489) has the molecular formula C22H33NO6P+ and a molecular weight of 438.48 g/mol. Its IUPAC name is 2-[2,3-bis(2-methylphenoxy)propoxy-hydroxyphosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[2,3-bis(2-methylphenoxy)propoxy-hydroxyphosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 175436489 |
| Molecular Formula | C22H33NO6P+ |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.20 |
| IUPAC Name | 2-[2,3-bis(2-methylphenoxy)propoxy-hydroxyphosphoryl]oxyethyl-trimethylazanium |
| SMILES | Cc1ccccc1OCC(COP(=O)(O)OCC[N+](C)(C)C)Oc1ccccc1C |
| InChI | InChI=1S/C22H32NO6P/c1-18-10-6-8-12-21(18)26-16-20(29-22-13-9-7-11-19(22)2)17-28-30(24,25)27-15-14-23(3,4)5/h6-13,20H,14-17H2,1-5H3/p+1 |
| InChIKey | XNPAXWBIGCMPPY-UHFFFAOYSA-O |
| XLogP | 3.97 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|