C34H53N2O14P2+ — CID 71610629
2-[[2-[(2S)-2-aminopropanoyl]oxy-3-[1,3-bis(4-phenylbutanoyloxy)propan-2-yloxy-hydroxyphosphoryl]oxypropoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium (PubChem CID 71610629) has the molecular formula C34H53N2O14P2+ and a molecular weight of 775.75 g/mol. Its IUPAC name is 2-[[2-[(2S)-2-aminopropanoyl]oxy-3-[1,3-bis(4-phenylbutanoyloxy)propan-2-yloxy-hydroxyphosphoryl]oxypropoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[[2-[(2S)-2-aminopropanoyl]oxy-3-[1,3-bis(4-phenylbutanoyloxy)propan-2-yloxy-hydroxyphosphoryl]oxypropoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 71610629 |
| Molecular Formula | C34H53N2O14P2+ |
| Molecular Weight | 775.75 g/mol |
| Exact Mass | 775.30 |
| IUPAC Name | 2-[[2-[(2S)-2-aminopropanoyl]oxy-3-[1,3-bis(4-phenylbutanoyloxy)propan-2-yloxy-hydroxyphosphoryl]oxypropoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium |
| SMILES | C[C@H](N)C(=O)OC(COP(=O)(O)OCC[N+](C)(C)C)COP(=O)(O)OC(COC(=O)CCCc1ccccc1)COC(=O)CCCc1ccccc1 |
| InChI | InChI=1S/C34H52N2O14P2/c1-27(35)34(39)49-30(25-47-51(40,41)46-22-21-36(2,3)4)26-48-52(42,43)50-31(23-44-32(37)19-11-17-28-13-7-5-8-14-28)24-45-33(38)20-12-18-29-15-9-6-10-16-29/h5-10,13-16,27,30-31H,11-12,17-26,35H2,1-4H3,(H-,40,41,42,43)/p+1/t27-,30?/m0/s1 |
| InChIKey | LARGTMORIKMVBZ-CEBUJLNPSA-O |
| XLogP | 3.72 |
| TPSA | 216.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 775.75 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|