C48H65NO8P+ — CID 100939639
2-[[(2R)-2,3-bis[8-(4-phenylphenyl)octanoyloxy]propoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium (PubChem CID 100939639) has the molecular formula C48H65NO8P+ and a molecular weight of 815.02 g/mol. Its IUPAC name is 2-[[(2R)-2,3-bis[8-(4-phenylphenyl)octanoyloxy]propoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[[(2R)-2,3-bis[8-(4-phenylphenyl)octanoyloxy]propoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 100939639 |
| Molecular Formula | C48H65NO8P+ |
| Molecular Weight | 815.02 g/mol |
| Exact Mass | 814.44 |
| IUPAC Name | 2-[[(2R)-2,3-bis[8-(4-phenylphenyl)octanoyloxy]propoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium |
| SMILES | C[N+](C)(C)CCOP(=O)(O)OC[C@@H](COC(=O)CCCCCCCc1ccc(-c2ccccc2)cc1)OC(=O)CCCCCCCc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C48H64NO8P/c1-49(2,3)36-37-55-58(52,53)56-39-46(57-48(51)27-19-9-5-7-13-21-41-30-34-45(35-31-41)43-24-16-11-17-25-43)38-54-47(50)26-18-8-4-6-12-20-40-28-32-44(33-29-40)42-22-14-10-15-23-42/h10-11,14-17,22-25,28-35,46H,4-9,12-13,18-21,26-27,36-39H2,1-3H3/p+1/t46-/m1/s1 |
| InChIKey | YRYIYRSXFCSCOI-YACUFSJGSA-O |
| XLogP | 10.78 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 815.02 |
| LogP ≤ 5 | 10.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|