C27H37NO4P+ — CID 102414878
2-[hydroxy-[4-[4-[(1E,3E,5E)-6-phenylhexa-1,3,5-trienyl]phenyl]butoxy]phosphoryl]oxyethyl-trimethylazanium (PubChem CID 102414878) has the molecular formula C27H37NO4P+ and a molecular weight of 470.57 g/mol. Its IUPAC name is 2-[hydroxy-[4-[4-[(1E,3E,5E)-6-phenylhexa-1,3,5-trienyl]phenyl]butoxy]phosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[hydroxy-[4-[4-[(1E,3E,5E)-6-phenylhexa-1,3,5-trienyl]phenyl]butoxy]phosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 102414878 |
| Molecular Formula | C27H37NO4P+ |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.25 |
| IUPAC Name | 2-[hydroxy-[4-[4-[(1E,3E,5E)-6-phenylhexa-1,3,5-trienyl]phenyl]butoxy]phosphoryl]oxyethyl-trimethylazanium |
| SMILES | C[N+](C)(C)CCOP(=O)(O)OCCCCc1ccc(/C=C/C=C/C=C/c2ccccc2)cc1 |
| InChI | InChI=1S/C27H36NO4P/c1-28(2,3)22-24-32-33(29,30)31-23-12-11-17-27-20-18-26(19-21-27)16-8-5-4-7-13-25-14-9-6-10-15-25/h4-10,13-16,18-21H,11-12,17,22-24H2,1-3H3/p+1/b5-4+,13-7+,16-8+ |
| InChIKey | VSZJFCHCPKTBNH-JDXZUNJUSA-O |
| XLogP | 6.13 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|