C24H36NO4P — CID 23730352
[(6E,8E,10E,12E)-13-phenyltrideca-6,8,10,12-tetraenyl] 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 23730352) has the molecular formula C24H36NO4P and a molecular weight of 433.53 g/mol. Its IUPAC name is [(6E,8E,10E,12E)-13-phenyltrideca-6,8,10,12-tetraenyl] 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | [(6E,8E,10E,12E)-13-phenyltrideca-6,8,10,12-tetraenyl] 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 23730352 |
| Molecular Formula | C24H36NO4P |
| Molecular Weight | 433.53 g/mol |
| Exact Mass | 433.24 |
| IUPAC Name | [(6E,8E,10E,12E)-13-phenyltrideca-6,8,10,12-tetraenyl] 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | C[N+](C)(C)CCOP(=O)([O-])OCCCCC/C=C/C=C/C=C/C=C/c1ccccc1 |
| InChI | InChI=1S/C24H36NO4P/c1-25(2,3)21-23-29-30(26,27)28-22-17-12-10-8-6-4-5-7-9-11-14-18-24-19-15-13-16-20-24/h4-7,9,11,13-16,18-20H,8,10,12,17,21-23H2,1-3H3/b6-4+,7-5+,11-9+,18-14+ |
| InChIKey | RCGDOVVFVRSMHN-AMXQBDPISA-N |
| XLogP | 5.14 |
| TPSA | 58.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.53 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|