About 5-cyclodecylidenepentyl 2-(trimethylazaniumyl)ethyl phosphate
5-cyclodecylidenepentyl 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 24801551) has the molecular formula C20H40NO4P
and a molecular weight of 389.52 g/mol. Its IUPAC name is 5-cyclodecylidenepentyl 2-(trimethylazaniumyl)ethyl phosphate.
Molecular Properties
| Compound Name | 5-cyclodecylidenepentyl 2-(trimethylazaniumyl)ethyl phosphate |
| PubChem CID | 24801551 |
| Molecular Formula | C20H40NO4P |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.27 |
| IUPAC Name | 5-cyclodecylidenepentyl 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | C[N+](C)(C)CCOP(=O)([O-])OCCCCC=C1CCCCCCCCC1 |
| InChI | InChI=1S/C20H40NO4P/c1-21(2,3)17-19-25-26(22,23)24-18-13-9-12-16-20-14-10-7-5-4-6-8-11-15-20/h16H,4-15,17-19H2,1-3H3 |
| InChIKey | KPRGVVATJNBTQX-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 58.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 5-cyclodecylidenepentyl 2-(trimethylazaniumyl)ethyl phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cyclodecylidenepentyl 2-(trimethylazaniumyl)ethyl phosphate?
The IUPAC name of 5-cyclodecylidenepentyl 2-(trimethylazaniumyl)ethyl phosphate (CID 24801551) is 5-cyclodecylidenepentyl 2-(trimethylazaniumyl)ethyl phosphate.
What is the SMILES notation for 5-cyclodecylidenepentyl 2-(trimethylazaniumyl)ethyl phosphate?
The canonical SMILES for 5-cyclodecylidenepentyl 2-(trimethylazaniumyl)ethyl phosphate is C[N+](C)(C)CCOP(=O)([O-])OCCCCC=C1CCCCCCCCC1.
What is the InChIKey of 5-cyclodecylidenepentyl 2-(trimethylazaniumyl)ethyl phosphate?
The InChIKey is KPRGVVATJNBTQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H40NO4P/c1-21(2,3)17-19-25-26(22,23)24-18-13-9-12-16-20-14-10-7-5-4-6-8-11-15-20/h16H,4-15,17-19H2,1-3H3.
What are the key properties of 5-cyclodecylidenepentyl 2-(trimethylazaniumyl)ethyl phosphate?
5-cyclodecylidenepentyl 2-(trimethylazaniumyl)ethyl phosphate has a molecular weight of 389.52 g/mol, XLogP of 4.82, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyclodecylidenepentyl 2-(trimethylazaniumyl)ethyl phosphate is sourced from PubChem (CID 24801551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).