C29H53NO5P+ — CID 142741392
2-[2-[4-[(Z)-hexadec-9-enoxy]phenyl]ethoxy-hydroxyphosphoryl]oxyethyl-trimethylazanium (PubChem CID 142741392) has the molecular formula C29H53NO5P+ and a molecular weight of 526.72 g/mol. Its IUPAC name is 2-[2-[4-[(Z)-hexadec-9-enoxy]phenyl]ethoxy-hydroxyphosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[2-[4-[(Z)-hexadec-9-enoxy]phenyl]ethoxy-hydroxyphosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 142741392 |
| Molecular Formula | C29H53NO5P+ |
| Molecular Weight | 526.72 g/mol |
| Exact Mass | 526.37 |
| IUPAC Name | 2-[2-[4-[(Z)-hexadec-9-enoxy]phenyl]ethoxy-hydroxyphosphoryl]oxyethyl-trimethylazanium |
| SMILES | CCCCCC/C=C\CCCCCCCCOc1ccc(CCOP(=O)(O)OCC[N+](C)(C)C)cc1 |
| InChI | InChI=1S/C29H52NO5P/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-25-33-29-21-19-28(20-22-29)23-26-34-36(31,32)35-27-24-30(2,3)4/h10-11,19-22H,5-9,12-18,23-27H2,1-4H3/p+1/b11-10- |
| InChIKey | YAGOYXDGMJSSRJ-KHPPLWFESA-O |
| XLogP | 7.70 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.72 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|