C46H78N2O6P+ — CID 132511786
2-[4-[[4-[10-[hydroxy-[(Z)-octadec-9-enoxy]phosphoryl]oxydecoxy]phenyl]methylideneamino]phenoxy]ethyl-trimethylazanium (PubChem CID 132511786) has the molecular formula C46H78N2O6P+ and a molecular weight of 786.11 g/mol. Its IUPAC name is 2-[4-[[4-[10-[hydroxy-[(Z)-octadec-9-enoxy]phosphoryl]oxydecoxy]phenyl]methylideneamino]phenoxy]ethyl-trimethylazanium.
| Compound Name | 2-[4-[[4-[10-[hydroxy-[(Z)-octadec-9-enoxy]phosphoryl]oxydecoxy]phenyl]methylideneamino]phenoxy]ethyl-trimethylazanium |
|---|---|
| PubChem CID | 132511786 |
| Molecular Formula | C46H78N2O6P+ |
| Molecular Weight | 786.11 g/mol |
| Exact Mass | 785.56 |
| IUPAC Name | 2-[4-[[4-[10-[hydroxy-[(Z)-octadec-9-enoxy]phosphoryl]oxydecoxy]phenyl]methylideneamino]phenoxy]ethyl-trimethylazanium |
| SMILES | CCCCCCCC/C=C\CCCCCCCCOP(=O)(O)OCCCCCCCCCCOc1ccc(/C=N/c2ccc(OCC[N+](C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C46H77N2O6P/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-21-24-27-39-53-55(49,50)54-40-28-25-22-19-18-20-23-26-38-51-45-33-29-43(30-34-45)42-47-44-31-35-46(36-32-44)52-41-37-48(2,3)4/h12-13,29-36,42H,5-11,14-28,37-41H2,1-4H3/p+1/b13-12-,47-42+ |
| InChIKey | LKSWMZNWOCGBJN-NDCRKGIESA-O |
| XLogP | 13.19 |
| TPSA | 86.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 786.11 |
| LogP ≤ 5 | 13.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|