C34H59O6P — CID 101470818
10-(4-formylphenoxy)decyl [(E)-heptadec-8-enyl] hydrogen phosphate (PubChem CID 101470818) has the molecular formula C34H59O6P and a molecular weight of 594.81 g/mol. Its IUPAC name is 10-(4-formylphenoxy)decyl [(E)-heptadec-8-enyl] hydrogen phosphate.
| Compound Name | 10-(4-formylphenoxy)decyl [(E)-heptadec-8-enyl] hydrogen phosphate |
|---|---|
| PubChem CID | 101470818 |
| Molecular Formula | C34H59O6P |
| Molecular Weight | 594.81 g/mol |
| Exact Mass | 594.40 |
| IUPAC Name | 10-(4-formylphenoxy)decyl [(E)-heptadec-8-enyl] hydrogen phosphate |
| SMILES | CCCCCCCC/C=C/CCCCCCCOP(=O)(O)OCCCCCCCCCCOc1ccc(C=O)cc1 |
| InChI | InChI=1S/C34H59O6P/c1-2-3-4-5-6-7-8-9-10-11-12-13-17-20-23-30-39-41(36,37)40-31-24-21-18-15-14-16-19-22-29-38-34-27-25-33(32-35)26-28-34/h9-10,25-28,32H,2-8,11-24,29-31H2,1H3,(H,36,37)/b10-9+ |
| InChIKey | YUCHFKCFWGKBDN-MDZDMXLPSA-N |
| XLogP | 10.78 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.81 |
| LogP ≤ 5 | 10.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|