About 2-cyanoethyl 10-(4-formylphenoxy)decyl [(Z)-octadec-9-enyl] phosphate
2-cyanoethyl 10-(4-formylphenoxy)decyl [(Z)-octadec-9-enyl] phosphate (PubChem CID 102430921) has the molecular formula C38H64NO6P
and a molecular weight of 661.91 g/mol. Its IUPAC name is 2-cyanoethyl 10-(4-formylphenoxy)decyl [(Z)-octadec-9-enyl] phosphate.
Molecular Properties
| Compound Name | 2-cyanoethyl 10-(4-formylphenoxy)decyl [(Z)-octadec-9-enyl] phosphate |
| PubChem CID | 102430921 |
| Molecular Formula | C38H64NO6P |
| Molecular Weight | 661.91 g/mol |
| Exact Mass | 661.45 |
| IUPAC Name | 2-cyanoethyl 10-(4-formylphenoxy)decyl [(Z)-octadec-9-enyl] phosphate |
| SMILES | CCCCCCCC/C=C\CCCCCCCCOP(=O)(OCCC#N)OCCCCCCCCCCOc1ccc(C=O)cc1 |
| InChI | InChI=1S/C38H64NO6P/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-18-21-24-33-43-46(41,45-35-26-31-39)44-34-25-22-19-16-15-17-20-23-32-42-38-29-27-37(36-40)28-30-38/h9-10,27-30,36H,2-8,11-26,32-35H2,1H3/b10-9- |
| InChIKey | QMCYTUIPKKZCOE-KTKRTIGZSA-N |
| XLogP | 12.11 |
| TPSA | 94.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 46 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 661.91 |
| LogP ≤ 5 | 12.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-cyanoethyl 10-(4-formylphenoxy)decyl [(Z)-octadec-9-enyl] phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyanoethyl 10-(4-formylphenoxy)decyl [(Z)-octadec-9-enyl] phosphate?
The IUPAC name of 2-cyanoethyl 10-(4-formylphenoxy)decyl [(Z)-octadec-9-enyl] phosphate (CID 102430921) is 2-cyanoethyl 10-(4-formylphenoxy)decyl [(Z)-octadec-9-enyl] phosphate.
What is the SMILES notation for 2-cyanoethyl 10-(4-formylphenoxy)decyl [(Z)-octadec-9-enyl] phosphate?
The canonical SMILES for 2-cyanoethyl 10-(4-formylphenoxy)decyl [(Z)-octadec-9-enyl] phosphate is CCCCCCCC/C=C\CCCCCCCCOP(=O)(OCCC#N)OCCCCCCCCCCOc1ccc(C=O)cc1.
What is the InChIKey of 2-cyanoethyl 10-(4-formylphenoxy)decyl [(Z)-octadec-9-enyl] phosphate?
The InChIKey is QMCYTUIPKKZCOE-KTKRTIGZSA-N. The full InChI is InChI=1S/C38H64NO6P/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-18-21-24-33-43-46(41,45-35-26-31-39)44-34-25-22-19-16-15-17-20-23-32-42-38-29-27-37(36-40)28-30-38/h9-10,27-30,36H,2-8,11-26,32-35H2,1H3/b10-9-.
What are the key properties of 2-cyanoethyl 10-(4-formylphenoxy)decyl [(Z)-octadec-9-enyl] phosphate?
2-cyanoethyl 10-(4-formylphenoxy)decyl [(Z)-octadec-9-enyl] phosphate has a molecular weight of 661.91 g/mol, XLogP of 12.11, 34 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyanoethyl 10-(4-formylphenoxy)decyl [(Z)-octadec-9-enyl] phosphate is sourced from PubChem (CID 102430921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).