C35H60O6P- — CID 132916150
10-(4-formylphenoxy)decyl [(Z)-octadec-9-enyl] phosphate (PubChem CID 132916150) has the molecular formula C35H60O6P- and a molecular weight of 607.83 g/mol. Its IUPAC name is 10-(4-formylphenoxy)decyl [(Z)-octadec-9-enyl] phosphate.
| Compound Name | 10-(4-formylphenoxy)decyl [(Z)-octadec-9-enyl] phosphate |
|---|---|
| PubChem CID | 132916150 |
| Molecular Formula | C35H60O6P- |
| Molecular Weight | 607.83 g/mol |
| Exact Mass | 607.41 |
| IUPAC Name | 10-(4-formylphenoxy)decyl [(Z)-octadec-9-enyl] phosphate |
| SMILES | CCCCCCCC/C=C\CCCCCCCCOP(=O)([O-])OCCCCCCCCCCOc1ccc(C=O)cc1 |
| InChI | InChI=1S/C35H61O6P/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-18-21-24-31-40-42(37,38)41-32-25-22-19-16-15-17-20-23-30-39-35-28-26-34(33-36)27-29-35/h9-10,26-29,33H,2-8,11-25,30-32H2,1H3,(H,37,38)/p-1/b10-9- |
| InChIKey | OCOLQVNQYWHIHM-KTKRTIGZSA-M |
| XLogP | 10.54 |
| TPSA | 84.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.83 |
| LogP ≤ 5 | 10.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|