About 4-(4-hexoxyphenyl)benzaldehyde;methanol;octan-2-ol
4-(4-hexoxyphenyl)benzaldehyde;methanol;octan-2-ol (PubChem CID 145140760) has the molecular formula C28H44O4
and a molecular weight of 444.66 g/mol. Its IUPAC name is 4-(4-hexoxyphenyl)benzaldehyde;methanol;octan-2-ol.
Molecular Properties
| Compound Name | 4-(4-hexoxyphenyl)benzaldehyde;methanol;octan-2-ol |
| PubChem CID | 145140760 |
| Molecular Formula | C28H44O4 |
| Molecular Weight | 444.66 g/mol |
| Exact Mass | 444.32 |
| IUPAC Name | 4-(4-hexoxyphenyl)benzaldehyde;methanol;octan-2-ol |
| SMILES | CCCCCCC(C)O.CCCCCCOc1ccc(-c2ccc(C=O)cc2)cc1.CO |
| InChI | InChI=1S/C19H22O2.C8H18O.CH4O/c1-2-3-4-5-14-21-19-12-10-18(11-13-19)17-8-6-16(15-20)7-9-17;1-3-4-5-6-7-8(2)9;1-2/h6-13,15H,2-5,14H2,1H3;8-9H,3-7H2,1-2H3;2H,1H3 |
| InChIKey | JKWCDAXAQYALKE-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 444.66 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-hexoxyphenyl)benzaldehyde;methanol;octan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-hexoxyphenyl)benzaldehyde;methanol;octan-2-ol?
The IUPAC name of 4-(4-hexoxyphenyl)benzaldehyde;methanol;octan-2-ol (CID 145140760) is 4-(4-hexoxyphenyl)benzaldehyde;methanol;octan-2-ol.
What is the SMILES notation for 4-(4-hexoxyphenyl)benzaldehyde;methanol;octan-2-ol?
The canonical SMILES for 4-(4-hexoxyphenyl)benzaldehyde;methanol;octan-2-ol is CCCCCCC(C)O.CCCCCCOc1ccc(-c2ccc(C=O)cc2)cc1.CO.
What is the InChIKey of 4-(4-hexoxyphenyl)benzaldehyde;methanol;octan-2-ol?
The InChIKey is JKWCDAXAQYALKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22O2.C8H18O.CH4O/c1-2-3-4-5-14-21-19-12-10-18(11-13-19)17-8-6-16(15-20)7-9-17;1-3-4-5-6-7-8(2)9;1-2/h6-13,15H,2-5,14H2,1H3;8-9H,3-7H2,1-2H3;2H,1H3.
What are the key properties of 4-(4-hexoxyphenyl)benzaldehyde;methanol;octan-2-ol?
4-(4-hexoxyphenyl)benzaldehyde;methanol;octan-2-ol has a molecular weight of 444.66 g/mol, XLogP of 7.07, 13 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-hexoxyphenyl)benzaldehyde;methanol;octan-2-ol is sourced from PubChem (CID 145140760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).