C15H24O3 — CID 175326369
2,3-dimethyl-3-(3-phenoxypropoxy)butan-2-ol (PubChem CID 175326369) has the molecular formula C15H24O3 and a molecular weight of 252.35 g/mol. Its IUPAC name is 2,3-dimethyl-3-(3-phenoxypropoxy)butan-2-ol.
| Compound Name | 2,3-dimethyl-3-(3-phenoxypropoxy)butan-2-ol |
|---|---|
| PubChem CID | 175326369 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | 2,3-dimethyl-3-(3-phenoxypropoxy)butan-2-ol |
| SMILES | CC(C)(O)C(C)(C)OCCCOc1ccccc1 |
| InChI | InChI=1S/C15H24O3/c1-14(2,16)15(3,4)18-12-8-11-17-13-9-6-5-7-10-13/h5-7,9-10,16H,8,11-12H2,1-4H3 |
| InChIKey | MQMROIHCUGRMKA-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|