C18H30O3 — CID 141071061
3,3,5,5-tetramethyl-2-(2-phenoxyethoxy)hexan-2-ol (PubChem CID 141071061) has the molecular formula C18H30O3 and a molecular weight of 294.43 g/mol. Its IUPAC name is 3,3,5,5-tetramethyl-2-(2-phenoxyethoxy)hexan-2-ol.
| Compound Name | 3,3,5,5-tetramethyl-2-(2-phenoxyethoxy)hexan-2-ol |
|---|---|
| PubChem CID | 141071061 |
| Molecular Formula | C18H30O3 |
| Molecular Weight | 294.43 g/mol |
| Exact Mass | 294.22 |
| IUPAC Name | 3,3,5,5-tetramethyl-2-(2-phenoxyethoxy)hexan-2-ol |
| SMILES | CC(C)(C)CC(C)(C)C(C)(O)OCCOc1ccccc1 |
| InChI | InChI=1S/C18H30O3/c1-16(2,3)14-17(4,5)18(6,19)21-13-12-20-15-10-8-7-9-11-15/h7-11,19H,12-14H2,1-6H3 |
| InChIKey | FVINUEAWLDMBIR-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.43 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|