C14H25NO8P2 — CID 11784267
[3-[ethyl(3-phenoxypropyl)amino]-1-hydroxy-1-phosphonopropyl]phosphonic acid (PubChem CID 11784267) has the molecular formula C14H25NO8P2 and a molecular weight of 397.30 g/mol. Its IUPAC name is [3-[ethyl(3-phenoxypropyl)amino]-1-hydroxy-1-phosphonopropyl]phosphonic acid.
| Compound Name | [3-[ethyl(3-phenoxypropyl)amino]-1-hydroxy-1-phosphonopropyl]phosphonic acid |
|---|---|
| PubChem CID | 11784267 |
| Molecular Formula | C14H25NO8P2 |
| Molecular Weight | 397.30 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | [3-[ethyl(3-phenoxypropyl)amino]-1-hydroxy-1-phosphonopropyl]phosphonic acid |
| SMILES | CCN(CCCOc1ccccc1)CCC(O)(P(=O)(O)O)P(=O)(O)O |
| InChI | InChI=1S/C14H25NO8P2/c1-2-15(10-6-12-23-13-7-4-3-5-8-13)11-9-14(16,24(17,18)19)25(20,21)22/h3-5,7-8,16H,2,6,9-12H2,1H3,(H2,17,18,19)(H2,20,21,22) |
| InChIKey | SJAPBLIGKOKZLV-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 147.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.30 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|