C46H56N2O9 — CID 58194645
2-[2-[3-[3-(4-benzoylphenoxy)propyl-ethylamino]propanoyloxy]ethoxy]ethyl 3-[3-(4-benzoylphenoxy)propyl-ethylamino]propanoate (PubChem CID 58194645) has the molecular formula C46H56N2O9 and a molecular weight of 780.96 g/mol. Its IUPAC name is 2-[2-[3-[3-(4-benzoylphenoxy)propyl-ethylamino]propanoyloxy]ethoxy]ethyl 3-[3-(4-benzoylphenoxy)propyl-ethylamino]propanoate.
| Compound Name | 2-[2-[3-[3-(4-benzoylphenoxy)propyl-ethylamino]propanoyloxy]ethoxy]ethyl 3-[3-(4-benzoylphenoxy)propyl-ethylamino]propanoate |
|---|---|
| PubChem CID | 58194645 |
| Molecular Formula | C46H56N2O9 |
| Molecular Weight | 780.96 g/mol |
| Exact Mass | 780.40 |
| IUPAC Name | 2-[2-[3-[3-(4-benzoylphenoxy)propyl-ethylamino]propanoyloxy]ethoxy]ethyl 3-[3-(4-benzoylphenoxy)propyl-ethylamino]propanoate |
| SMILES | CCN(CCCOc1ccc(C(=O)c2ccccc2)cc1)CCC(=O)OCCOCCOC(=O)CCN(CC)CCCOc1ccc(C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C46H56N2O9/c1-3-47(27-11-31-54-41-21-17-39(18-22-41)45(51)37-13-7-5-8-14-37)29-25-43(49)56-35-33-53-34-36-57-44(50)26-30-48(4-2)28-12-32-55-42-23-19-40(20-24-42)46(52)38-15-9-6-10-16-38/h5-10,13-24H,3-4,11-12,25-36H2,1-2H3 |
| InChIKey | CWUZXGQHGRVQGZ-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 120.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 780.96 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|