C35H49NO8 — CID 134197930
5-[4-[4-[6-[3-[ethyl(2-hydroxyethyl)amino]propanoyloxy]hexoxy]benzoyl]phenoxy]pentyl 2-methylprop-2-enoate (PubChem CID 134197930) has the molecular formula C35H49NO8 and a molecular weight of 611.78 g/mol. Its IUPAC name is 5-[4-[4-[6-[3-[ethyl(2-hydroxyethyl)amino]propanoyloxy]hexoxy]benzoyl]phenoxy]pentyl 2-methylprop-2-enoate.
| Compound Name | 5-[4-[4-[6-[3-[ethyl(2-hydroxyethyl)amino]propanoyloxy]hexoxy]benzoyl]phenoxy]pentyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 134197930 |
| Molecular Formula | C35H49NO8 |
| Molecular Weight | 611.78 g/mol |
| Exact Mass | 611.35 |
| IUPAC Name | 5-[4-[4-[6-[3-[ethyl(2-hydroxyethyl)amino]propanoyloxy]hexoxy]benzoyl]phenoxy]pentyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCCCOc1ccc(C(=O)c2ccc(OCCCCCCOC(=O)CCN(CC)CCO)cc2)cc1 |
| InChI | InChI=1S/C35H49NO8/c1-4-36(22-23-37)21-20-33(38)43-26-9-6-5-8-24-41-31-16-12-29(13-17-31)34(39)30-14-18-32(19-15-30)42-25-10-7-11-27-44-35(40)28(2)3/h12-19,37H,2,4-11,20-27H2,1,3H3 |
| InChIKey | LPOVZCAQYOYLDL-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 111.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.78 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|