C12H19O3P — CID 949317
[(1S)-1-hydroxy-2-methylpropyl]-(2-phenylethyl)phosphinic acid (PubChem CID 949317) has the molecular formula C12H19O3P and a molecular weight of 242.25 g/mol. Its IUPAC name is [(1S)-1-hydroxy-2-methylpropyl]-(2-phenylethyl)phosphinic acid.
| Compound Name | [(1S)-1-hydroxy-2-methylpropyl]-(2-phenylethyl)phosphinic acid |
|---|---|
| PubChem CID | 949317 |
| Molecular Formula | C12H19O3P |
| Molecular Weight | 242.25 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | [(1S)-1-hydroxy-2-methylpropyl]-(2-phenylethyl)phosphinic acid |
| SMILES | CC(C)[C@@H](O)P(=O)(O)CCc1ccccc1 |
| InChI | InChI=1S/C12H19O3P/c1-10(2)12(13)16(14,15)9-8-11-6-4-3-5-7-11/h3-7,10,12-13H,8-9H2,1-2H3,(H,14,15)/t12-/m0/s1 |
| InChIKey | XMDMSDCYKWBMBH-LBPRGKRZSA-N |
| XLogP | 2.47 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.25 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|