C15H18NO3P — CID 4834993
[amino-(4-hydroxyphenyl)methyl]-(2-phenylethyl)phosphinic acid (PubChem CID 4834993) has the molecular formula C15H18NO3P and a molecular weight of 291.29 g/mol. Its IUPAC name is [amino-(4-hydroxyphenyl)methyl]-(2-phenylethyl)phosphinic acid.
| Compound Name | [amino-(4-hydroxyphenyl)methyl]-(2-phenylethyl)phosphinic acid |
|---|---|
| PubChem CID | 4834993 |
| Molecular Formula | C15H18NO3P |
| Molecular Weight | 291.29 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | [amino-(4-hydroxyphenyl)methyl]-(2-phenylethyl)phosphinic acid |
| SMILES | NC(c1ccc(O)cc1)P(=O)(O)CCc1ccccc1 |
| InChI | InChI=1S/C15H18NO3P/c16-15(13-6-8-14(17)9-7-13)20(18,19)11-10-12-4-2-1-3-5-12/h1-9,15,17H,10-11,16H2,(H,18,19) |
| InChIKey | MRXPNQGIGBFFCW-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.29 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|