C8H14NO5P — CID 3029836
4-(2-aminoethyl)phenol;phosphoric acid (PubChem CID 3029836) has the molecular formula C8H14NO5P and a molecular weight of 235.18 g/mol. Its IUPAC name is 4-(2-aminoethyl)phenol;phosphoric acid.
| Compound Name | 4-(2-aminoethyl)phenol;phosphoric acid |
|---|---|
| PubChem CID | 3029836 |
| Molecular Formula | C8H14NO5P |
| Molecular Weight | 235.18 g/mol |
| Exact Mass | 235.06 |
| IUPAC Name | 4-(2-aminoethyl)phenol;phosphoric acid |
| SMILES | NCCc1ccc(O)cc1.O=P(O)(O)O |
| InChI | InChI=1S/C8H11NO.H3O4P/c9-6-5-7-1-3-8(10)4-2-7;1-5(2,3)4/h1-4,10H,5-6,9H2;(H3,1,2,3,4) |
| InChIKey | MUPIJBRZGOUZNY-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 124.01 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.18 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|