About 4-(2-aminoethyl)phenol;2-ethoxyethanamine
4-(2-aminoethyl)phenol;2-ethoxyethanamine (PubChem CID 70105450) has the molecular formula C12H22N2O2
and a molecular weight of 226.32 g/mol. Its IUPAC name is 4-(2-aminoethyl)phenol;2-ethoxyethanamine.
Molecular Properties
| Compound Name | 4-(2-aminoethyl)phenol;2-ethoxyethanamine |
| PubChem CID | 70105450 |
| Molecular Formula | C12H22N2O2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | 4-(2-aminoethyl)phenol;2-ethoxyethanamine |
| SMILES | CCOCCN.NCCc1ccc(O)cc1 |
| InChI | InChI=1S/C8H11NO.C4H11NO/c9-6-5-7-1-3-8(10)4-2-7;1-2-6-4-3-5/h1-4,10H,5-6,9H2;2-5H2,1H3 |
| InChIKey | LGEWBUDWXZWEIP-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 81.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-aminoethyl)phenol;2-ethoxyethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-aminoethyl)phenol;2-ethoxyethanamine?
The IUPAC name of 4-(2-aminoethyl)phenol;2-ethoxyethanamine (CID 70105450) is 4-(2-aminoethyl)phenol;2-ethoxyethanamine.
What is the SMILES notation for 4-(2-aminoethyl)phenol;2-ethoxyethanamine?
The canonical SMILES for 4-(2-aminoethyl)phenol;2-ethoxyethanamine is CCOCCN.NCCc1ccc(O)cc1.
What is the InChIKey of 4-(2-aminoethyl)phenol;2-ethoxyethanamine?
The InChIKey is LGEWBUDWXZWEIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO.C4H11NO/c9-6-5-7-1-3-8(10)4-2-7;1-2-6-4-3-5/h1-4,10H,5-6,9H2;2-5H2,1H3.
What are the key properties of 4-(2-aminoethyl)phenol;2-ethoxyethanamine?
4-(2-aminoethyl)phenol;2-ethoxyethanamine has a molecular weight of 226.32 g/mol, XLogP of 0.88, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-aminoethyl)phenol;2-ethoxyethanamine is sourced from PubChem (CID 70105450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).