C15H25N3O — CID 131740920
4-(2-aminoethyl)phenol;N,N'-di(propan-2-yl)methanediimine (PubChem CID 131740920) has the molecular formula C15H25N3O and a molecular weight of 263.38 g/mol. Its IUPAC name is 4-(2-aminoethyl)phenol;N,N'-di(propan-2-yl)methanediimine.
| Compound Name | 4-(2-aminoethyl)phenol;N,N'-di(propan-2-yl)methanediimine |
|---|---|
| PubChem CID | 131740920 |
| Molecular Formula | C15H25N3O |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.20 |
| IUPAC Name | 4-(2-aminoethyl)phenol;N,N'-di(propan-2-yl)methanediimine |
| SMILES | CC(C)N=C=NC(C)C.NCCc1ccc(O)cc1 |
| InChI | InChI=1S/C8H11NO.C7H14N2/c9-6-5-7-1-3-8(10)4-2-7;1-6(2)8-5-9-7(3)4/h1-4,10H,5-6,9H2;6-7H,1-4H3 |
| InChIKey | HAJGAHMPFUGFLQ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 70.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|