C17H24N2O3 — CID 67313836
4-(2-aminoethyl)phenol;4-[1-hydroxy-2-(methylamino)ethyl]phenol (PubChem CID 67313836) has the molecular formula C17H24N2O3 and a molecular weight of 304.39 g/mol. Its IUPAC name is 4-(2-aminoethyl)phenol;4-[1-hydroxy-2-(methylamino)ethyl]phenol.
| Compound Name | 4-(2-aminoethyl)phenol;4-[1-hydroxy-2-(methylamino)ethyl]phenol |
|---|---|
| PubChem CID | 67313836 |
| Molecular Formula | C17H24N2O3 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | 4-(2-aminoethyl)phenol;4-[1-hydroxy-2-(methylamino)ethyl]phenol |
| SMILES | CNCC(O)c1ccc(O)cc1.NCCc1ccc(O)cc1 |
| InChI | InChI=1S/C9H13NO2.C8H11NO/c1-10-6-9(12)7-2-4-8(11)5-3-7;9-6-5-7-1-3-8(10)4-2-7/h2-5,9-12H,6H2,1H3;1-4,10H,5-6,9H2 |
| InChIKey | GVFUVTBHTCWJQO-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |