C18H24NO3+ — CID 38988422
[(2R)-2-hydroxy-2-(4-hydroxyphenyl)ethyl]-[(2S)-4-(4-hydroxyphenyl)butan-2-yl]azanium (PubChem CID 38988422) has the molecular formula C18H24NO3+ and a molecular weight of 302.39 g/mol. Its IUPAC name is [(2R)-2-hydroxy-2-(4-hydroxyphenyl)ethyl]-[(2S)-4-(4-hydroxyphenyl)butan-2-yl]azanium.
| Compound Name | [(2R)-2-hydroxy-2-(4-hydroxyphenyl)ethyl]-[(2S)-4-(4-hydroxyphenyl)butan-2-yl]azanium |
|---|---|
| PubChem CID | 38988422 |
| Molecular Formula | C18H24NO3+ |
| Molecular Weight | 302.39 g/mol |
| Exact Mass | 302.18 |
| IUPAC Name | [(2R)-2-hydroxy-2-(4-hydroxyphenyl)ethyl]-[(2S)-4-(4-hydroxyphenyl)butan-2-yl]azanium |
| SMILES | C[C@@H](CCc1ccc(O)cc1)[NH2+]C[C@H](O)c1ccc(O)cc1 |
| InChI | InChI=1S/C18H23NO3/c1-13(2-3-14-4-8-16(20)9-5-14)19-12-18(22)15-6-10-17(21)11-7-15/h4-11,13,18-22H,2-3,12H2,1H3/p+1/t13-,18-/m0/s1 |
| InChIKey | YJQZYXCXBBCEAQ-UGSOOPFHSA-O |
| XLogP | 1.72 |
| TPSA | 77.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.39 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |