C40H50N2O10 — CID 70592433
(E)-but-2-enedioate;bis([(2R)-2-hydroxy-2-(3-hydroxyphenyl)ethyl]-[(2R)-4-(4-hydroxyphenyl)butan-2-yl]azanium) (PubChem CID 70592433) has the molecular formula C40H50N2O10 and a molecular weight of 718.84 g/mol. Its IUPAC name is (E)-but-2-enedioate;bis([(2R)-2-hydroxy-2-(3-hydroxyphenyl)ethyl]-[(2R)-4-(4-hydroxyphenyl)butan-2-yl]azanium).
| Compound Name | (E)-but-2-enedioate;bis([(2R)-2-hydroxy-2-(3-hydroxyphenyl)ethyl]-[(2R)-4-(4-hydroxyphenyl)butan-2-yl]azanium) |
|---|---|
| PubChem CID | 70592433 |
| Molecular Formula | C40H50N2O10 |
| Molecular Weight | 718.84 g/mol |
| Exact Mass | 718.35 |
| IUPAC Name | (E)-but-2-enedioate;bis([(2R)-2-hydroxy-2-(3-hydroxyphenyl)ethyl]-[(2R)-4-(4-hydroxyphenyl)butan-2-yl]azanium) |
| SMILES | C[C@H](CCc1ccc(O)cc1)[NH2+]C[C@H](O)c1cccc(O)c1.C[C@H](CCc1ccc(O)cc1)[NH2+]C[C@H](O)c1cccc(O)c1.O=C([O-])/C=C/C(=O)[O-] |
| InChI | InChI=1S/2C18H23NO3.C4H4O4/c2*1-13(5-6-14-7-9-16(20)10-8-14)19-12-18(22)15-3-2-4-17(21)11-15;5-3(6)1-2-4(7)8/h2*2-4,7-11,13,18-22H,5-6,12H2,1H3;1-2H,(H,5,6)(H,7,8)/b;;2-1+/t2*13-,18+;/m11./s1 |
| InChIKey | NUJGMKGLHJBLBV-NXOHHGSUSA-N |
| XLogP | 0.47 |
| TPSA | 234.86 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.84 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|