C8H12NO5S- — CID 25267770
3-(2-amino-1-hydroxyethyl)phenol;hydrogen sulfite (PubChem CID 25267770) has the molecular formula C8H12NO5S- and a molecular weight of 234.25 g/mol. Its IUPAC name is 3-(2-amino-1-hydroxyethyl)phenol;hydrogen sulfite.
| Compound Name | 3-(2-amino-1-hydroxyethyl)phenol;hydrogen sulfite |
|---|---|
| PubChem CID | 25267770 |
| Molecular Formula | C8H12NO5S- |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.04 |
| IUPAC Name | 3-(2-amino-1-hydroxyethyl)phenol;hydrogen sulfite |
| SMILES | NCC(O)c1cccc(O)c1.O=S([O-])O |
| InChI | InChI=1S/C8H11NO2.H2O3S/c9-5-8(11)6-2-1-3-7(10)4-6;1-4(2)3/h1-4,8,10-11H,5,9H2;(H2,1,2,3)/p-1 |
| InChIKey | AKDPAPKKLDVQBC-UHFFFAOYSA-M |
| XLogP | -0.28 |
| TPSA | 126.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|