About 4-(2-amino-1-hydroxyethyl)phenol;sulfurous acid
4-(2-amino-1-hydroxyethyl)phenol;sulfurous acid (PubChem CID 11413666) has the molecular formula C8H13NO5S
and a molecular weight of 235.26 g/mol. Its IUPAC name is 4-(2-amino-1-hydroxyethyl)phenol;sulfurous acid.
Molecular Properties
| Compound Name | 4-(2-amino-1-hydroxyethyl)phenol;sulfurous acid |
| PubChem CID | 11413666 |
| Molecular Formula | C8H13NO5S |
| Molecular Weight | 235.26 g/mol |
| Exact Mass | 235.05 |
| IUPAC Name | 4-(2-amino-1-hydroxyethyl)phenol;sulfurous acid |
| SMILES | NCC(O)c1ccc(O)cc1.O=S(O)O |
| InChI | InChI=1S/C8H11NO2.H2O3S/c9-5-8(11)6-1-3-7(10)4-2-6;1-4(2)3/h1-4,8,10-11H,5,9H2;(H2,1,2,3) |
| InChIKey | RIRUGLKHLRTGPS-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 124.01 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.26 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-amino-1-hydroxyethyl)phenol;sulfurous acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-amino-1-hydroxyethyl)phenol;sulfurous acid?
The IUPAC name of 4-(2-amino-1-hydroxyethyl)phenol;sulfurous acid (CID 11413666) is 4-(2-amino-1-hydroxyethyl)phenol;sulfurous acid.
What is the SMILES notation for 4-(2-amino-1-hydroxyethyl)phenol;sulfurous acid?
The canonical SMILES for 4-(2-amino-1-hydroxyethyl)phenol;sulfurous acid is NCC(O)c1ccc(O)cc1.O=S(O)O.
What is the InChIKey of 4-(2-amino-1-hydroxyethyl)phenol;sulfurous acid?
The InChIKey is RIRUGLKHLRTGPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO2.H2O3S/c9-5-8(11)6-1-3-7(10)4-2-6;1-4(2)3/h1-4,8,10-11H,5,9H2;(H2,1,2,3).
What are the key properties of 4-(2-amino-1-hydroxyethyl)phenol;sulfurous acid?
4-(2-amino-1-hydroxyethyl)phenol;sulfurous acid has a molecular weight of 235.26 g/mol, XLogP of 0.07, 2 rotatable bonds, 5 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-amino-1-hydroxyethyl)phenol;sulfurous acid is sourced from PubChem (CID 11413666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).