C7H10O6S — CID 70629273
benzene-1,4-diol;formaldehyde;sulfurous acid (PubChem CID 70629273) has the molecular formula C7H10O6S and a molecular weight of 222.22 g/mol. Its IUPAC name is benzene-1,4-diol;formaldehyde;sulfurous acid.
| Compound Name | benzene-1,4-diol;formaldehyde;sulfurous acid |
|---|---|
| PubChem CID | 70629273 |
| Molecular Formula | C7H10O6S |
| Molecular Weight | 222.22 g/mol |
| Exact Mass | 222.02 |
| IUPAC Name | benzene-1,4-diol;formaldehyde;sulfurous acid |
| SMILES | C=O.O=S(O)O.Oc1ccc(O)cc1 |
| InChI | InChI=1S/C6H6O2.CH2O.H2O3S/c7-5-1-2-6(8)4-3-5;1-2;1-4(2)3/h1-4,7-8H;1H2;(H2,1,2,3) |
| InChIKey | ABTBNRULIDMHLT-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.22 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|