benzene-1,4-diol;formaldehyde;sulfurous acid

C7H10O6S — CID 70629273

IUPACbenzene-1,4-diol;formaldehyde;sulfurous acid
SMILESC=O.O=S(O)O.Oc1ccc(O)cc1
InChIInChI=1S/C6H6O2.CH2O.H2O3S/c7-5-1-2-6(8)4-3-5;1-2;1-4(2)3/h1-4,7-8H;1H2;(H2,1,2,3)
InChIKeyABTBNRULIDMHLT-UHFFFAOYSA-N
MW222.22 g/mol
LogP0.59
Rot. Bonds

About benzene-1,4-diol;formaldehyde;sulfurous acid

benzene-1,4-diol;formaldehyde;sulfurous acid (PubChem CID 70629273) has the molecular formula C7H10O6S and a molecular weight of 222.22 g/mol. Its IUPAC name is benzene-1,4-diol;formaldehyde;sulfurous acid.

Molecular Properties

Compound Namebenzene-1,4-diol;formaldehyde;sulfurous acid
PubChem CID70629273
Molecular FormulaC7H10O6S
Molecular Weight222.22 g/mol
Exact Mass222.02
IUPAC Namebenzene-1,4-diol;formaldehyde;sulfurous acid
SMILESC=O.O=S(O)O.Oc1ccc(O)cc1
InChIInChI=1S/C6H6O2.CH2O.H2O3S/c7-5-1-2-6(8)4-3-5;1-2;1-4(2)3/h1-4,7-8H;1H2;(H2,1,2,3)
InChIKeyABTBNRULIDMHLT-UHFFFAOYSA-N
XLogP0.59
TPSA115.06 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500222.22
LogP ≤ 50.59
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}

Analyze benzene-1,4-diol;formaldehyde;sulfurous acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of benzene-1,4-diol;formaldehyde;sulfurous acid?
The IUPAC name of benzene-1,4-diol;formaldehyde;sulfurous acid (CID 70629273) is benzene-1,4-diol;formaldehyde;sulfurous acid.
What is the SMILES notation for benzene-1,4-diol;formaldehyde;sulfurous acid?
The canonical SMILES for benzene-1,4-diol;formaldehyde;sulfurous acid is C=O.O=S(O)O.Oc1ccc(O)cc1.
What is the InChIKey of benzene-1,4-diol;formaldehyde;sulfurous acid?
The InChIKey is ABTBNRULIDMHLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6O2.CH2O.H2O3S/c7-5-1-2-6(8)4-3-5;1-2;1-4(2)3/h1-4,7-8H;1H2;(H2,1,2,3).
What are the key properties of benzene-1,4-diol;formaldehyde;sulfurous acid?
benzene-1,4-diol;formaldehyde;sulfurous acid has a molecular weight of 222.22 g/mol, XLogP of 0.59, 0 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzene-1,4-diol;formaldehyde;sulfurous acid is sourced from PubChem (CID 70629273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).