C10H15NO3 — CID 55263117
(1R,3S)-3-amino-1-(3-hydroxyphenyl)butane-1,4-diol (PubChem CID 55263117) has the molecular formula C10H15NO3 and a molecular weight of 197.23 g/mol. Its IUPAC name is (1R,3S)-3-amino-1-(3-hydroxyphenyl)butane-1,4-diol.
| Compound Name | (1R,3S)-3-amino-1-(3-hydroxyphenyl)butane-1,4-diol |
|---|---|
| PubChem CID | 55263117 |
| Molecular Formula | C10H15NO3 |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.11 |
| IUPAC Name | (1R,3S)-3-amino-1-(3-hydroxyphenyl)butane-1,4-diol |
| SMILES | N[C@H](CO)C[C@@H](O)c1cccc(O)c1 |
| InChI | InChI=1S/C10H15NO3/c11-8(6-12)5-10(14)7-2-1-3-9(13)4-7/h1-4,8,10,12-14H,5-6,11H2/t8-,10+/m0/s1 |
| InChIKey | JCEDTAGTKOMBBJ-WCBMZHEXSA-N |
| XLogP | 0.14 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |