C13H22ClNO2 — CID 171237097
3-[(1S,3S)-3-amino-1-hydroxy-4,4-dimethylpentyl]phenol;hydrochloride (PubChem CID 171237097) has the molecular formula C13H22ClNO2 and a molecular weight of 259.78 g/mol. Its IUPAC name is 3-[(1S,3S)-3-amino-1-hydroxy-4,4-dimethylpentyl]phenol;hydrochloride.
| Compound Name | 3-[(1S,3S)-3-amino-1-hydroxy-4,4-dimethylpentyl]phenol;hydrochloride |
|---|---|
| PubChem CID | 171237097 |
| Molecular Formula | C13H22ClNO2 |
| Molecular Weight | 259.78 g/mol |
| Exact Mass | 259.13 |
| IUPAC Name | 3-[(1S,3S)-3-amino-1-hydroxy-4,4-dimethylpentyl]phenol;hydrochloride |
| SMILES | CC(C)(C)[C@@H](N)C[C@H](O)c1cccc(O)c1.Cl |
| InChI | InChI=1S/C13H21NO2.ClH/c1-13(2,3)12(14)8-11(16)9-5-4-6-10(15)7-9;/h4-7,11-12,15-16H,8,14H2,1-3H3;1H/t11-,12-;/m0./s1 |
| InChIKey | FVYIQIUPVMGQPM-FXMYHANSSA-N |
| XLogP | 2.61 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.78 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |