C13H21NO3 — CID 171237120
4-[(1S,3S)-3-amino-1-hydroxy-4,4-dimethylpentyl]benzene-1,3-diol (PubChem CID 171237120) has the molecular formula C13H21NO3 and a molecular weight of 239.31 g/mol. Its IUPAC name is 4-[(1S,3S)-3-amino-1-hydroxy-4,4-dimethylpentyl]benzene-1,3-diol.
| Compound Name | 4-[(1S,3S)-3-amino-1-hydroxy-4,4-dimethylpentyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 171237120 |
| Molecular Formula | C13H21NO3 |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | 4-[(1S,3S)-3-amino-1-hydroxy-4,4-dimethylpentyl]benzene-1,3-diol |
| SMILES | CC(C)(C)[C@@H](N)C[C@H](O)c1ccc(O)cc1O |
| InChI | InChI=1S/C13H21NO3/c1-13(2,3)12(14)7-11(17)9-5-4-8(15)6-10(9)16/h4-6,11-12,15-17H,7,14H2,1-3H3/t11-,12-/m0/s1 |
| InChIKey | YNQSOMIKKFSQNZ-RYUDHWBXSA-N |
| XLogP | 1.89 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |