C8H10FNO2 — CID 130061010
4-(1-amino-2-fluoroethyl)benzene-1,3-diol (PubChem CID 130061010) has the molecular formula C8H10FNO2 and a molecular weight of 171.17 g/mol. Its IUPAC name is 4-(1-amino-2-fluoroethyl)benzene-1,3-diol.
| Compound Name | 4-(1-amino-2-fluoroethyl)benzene-1,3-diol |
|---|---|
| PubChem CID | 130061010 |
| Molecular Formula | C8H10FNO2 |
| Molecular Weight | 171.17 g/mol |
| Exact Mass | 171.07 |
| IUPAC Name | 4-(1-amino-2-fluoroethyl)benzene-1,3-diol |
| SMILES | NC(CF)c1ccc(O)cc1O |
| InChI | InChI=1S/C8H10FNO2/c9-4-7(10)6-2-1-5(11)3-8(6)12/h1-3,7,11-12H,4,10H2 |
| InChIKey | ASBJLAUHPDYDBM-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.17 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|