C9H14ClNO3 — CID 171200142
4-[(1R)-1-amino-3-hydroxypropyl]benzene-1,3-diol;hydrochloride (PubChem CID 171200142) has the molecular formula C9H14ClNO3 and a molecular weight of 219.67 g/mol. Its IUPAC name is 4-[(1R)-1-amino-3-hydroxypropyl]benzene-1,3-diol;hydrochloride.
| Compound Name | 4-[(1R)-1-amino-3-hydroxypropyl]benzene-1,3-diol;hydrochloride |
|---|---|
| PubChem CID | 171200142 |
| Molecular Formula | C9H14ClNO3 |
| Molecular Weight | 219.67 g/mol |
| Exact Mass | 219.07 |
| IUPAC Name | 4-[(1R)-1-amino-3-hydroxypropyl]benzene-1,3-diol;hydrochloride |
| SMILES | Cl.N[C@H](CCO)c1ccc(O)cc1O |
| InChI | InChI=1S/C9H13NO3.ClH/c10-8(3-4-11)7-2-1-6(12)5-9(7)13;/h1-2,5,8,11-13H,3-4,10H2;1H/t8-;/m1./s1 |
| InChIKey | MNTLLXVSQJIRDI-DDWIOCJRSA-N |
| XLogP | 0.90 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.67 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|