C10H12F3NO2 — CID 131872319
4-[(1S)-1-amino-3-hydroxypropyl]-3-(trifluoromethyl)phenol (PubChem CID 131872319) has the molecular formula C10H12F3NO2 and a molecular weight of 235.20 g/mol. Its IUPAC name is 4-[(1S)-1-amino-3-hydroxypropyl]-3-(trifluoromethyl)phenol.
| Compound Name | 4-[(1S)-1-amino-3-hydroxypropyl]-3-(trifluoromethyl)phenol |
|---|---|
| PubChem CID | 131872319 |
| Molecular Formula | C10H12F3NO2 |
| Molecular Weight | 235.20 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | 4-[(1S)-1-amino-3-hydroxypropyl]-3-(trifluoromethyl)phenol |
| SMILES | N[C@@H](CCO)c1ccc(O)cc1C(F)(F)F |
| InChI | InChI=1S/C10H12F3NO2/c11-10(12,13)8-5-6(16)1-2-7(8)9(14)3-4-15/h1-2,5,9,15-16H,3-4,14H2/t9-/m0/s1 |
| InChIKey | MVIFDLKYFGUSNZ-VIFPVBQESA-N |
| XLogP | 1.79 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.20 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |