C13H19Cl2NO — CID 171237440
(1S,3R)-3-amino-1-(3,4-dichlorophenyl)-4,4-dimethylpentan-1-ol (PubChem CID 171237440) has the molecular formula C13H19Cl2NO and a molecular weight of 276.21 g/mol. Its IUPAC name is (1S,3R)-3-amino-1-(3,4-dichlorophenyl)-4,4-dimethylpentan-1-ol.
| Compound Name | (1S,3R)-3-amino-1-(3,4-dichlorophenyl)-4,4-dimethylpentan-1-ol |
|---|---|
| PubChem CID | 171237440 |
| Molecular Formula | C13H19Cl2NO |
| Molecular Weight | 276.21 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | (1S,3R)-3-amino-1-(3,4-dichlorophenyl)-4,4-dimethylpentan-1-ol |
| SMILES | CC(C)(C)[C@H](N)C[C@H](O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H19Cl2NO/c1-13(2,3)12(16)7-11(17)8-4-5-9(14)10(15)6-8/h4-6,11-12,17H,7,16H2,1-3H3/t11-,12+/m0/s1 |
| InChIKey | ZKSHYOAOOXQSFL-NWDGAFQWSA-N |
| XLogP | 3.79 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.21 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |