About 4-(2-aminoethyl)aniline;4-(2-aminoethyl)phenol;2-(4-methoxyphenyl)ethanamine
4-(2-aminoethyl)aniline;4-(2-aminoethyl)phenol;2-(4-methoxyphenyl)ethanamine (PubChem CID 70275717) has the molecular formula C25H36N4O2
and a molecular weight of 424.59 g/mol. Its IUPAC name is 4-(2-aminoethyl)aniline;4-(2-aminoethyl)phenol;2-(4-methoxyphenyl)ethanamine.
Molecular Properties
| Compound Name | 4-(2-aminoethyl)aniline;4-(2-aminoethyl)phenol;2-(4-methoxyphenyl)ethanamine |
| PubChem CID | 70275717 |
| Molecular Formula | C25H36N4O2 |
| Molecular Weight | 424.59 g/mol |
| Exact Mass | 424.28 |
| IUPAC Name | 4-(2-aminoethyl)aniline;4-(2-aminoethyl)phenol;2-(4-methoxyphenyl)ethanamine |
| SMILES | COc1ccc(CCN)cc1.NCCc1ccc(N)cc1.NCCc1ccc(O)cc1 |
| InChI | InChI=1S/C9H13NO.C8H12N2.C8H11NO/c1-11-9-4-2-8(3-5-9)6-7-10;2*9-6-5-7-1-3-8(10)4-2-7/h2-5H,6-7,10H2,1H3;1-4H,5-6,9-10H2;1-4,10H,5-6,9H2 |
| InChIKey | BJRKJSXSIHKIFC-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 133.54 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 424.59 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-aminoethyl)aniline;4-(2-aminoethyl)phenol;2-(4-methoxyphenyl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-aminoethyl)aniline;4-(2-aminoethyl)phenol;2-(4-methoxyphenyl)ethanamine?
The IUPAC name of 4-(2-aminoethyl)aniline;4-(2-aminoethyl)phenol;2-(4-methoxyphenyl)ethanamine (CID 70275717) is 4-(2-aminoethyl)aniline;4-(2-aminoethyl)phenol;2-(4-methoxyphenyl)ethanamine.
What is the SMILES notation for 4-(2-aminoethyl)aniline;4-(2-aminoethyl)phenol;2-(4-methoxyphenyl)ethanamine?
The canonical SMILES for 4-(2-aminoethyl)aniline;4-(2-aminoethyl)phenol;2-(4-methoxyphenyl)ethanamine is COc1ccc(CCN)cc1.NCCc1ccc(N)cc1.NCCc1ccc(O)cc1.
What is the InChIKey of 4-(2-aminoethyl)aniline;4-(2-aminoethyl)phenol;2-(4-methoxyphenyl)ethanamine?
The InChIKey is BJRKJSXSIHKIFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO.C8H12N2.C8H11NO/c1-11-9-4-2-8(3-5-9)6-7-10;2*9-6-5-7-1-3-8(10)4-2-7/h2-5H,6-7,10H2,1H3;1-4H,5-6,9-10H2;1-4,10H,5-6,9H2.
What are the key properties of 4-(2-aminoethyl)aniline;4-(2-aminoethyl)phenol;2-(4-methoxyphenyl)ethanamine?
4-(2-aminoethyl)aniline;4-(2-aminoethyl)phenol;2-(4-methoxyphenyl)ethanamine has a molecular weight of 424.59 g/mol, XLogP of 2.86, 7 rotatable bonds, 5 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-aminoethyl)aniline;4-(2-aminoethyl)phenol;2-(4-methoxyphenyl)ethanamine is sourced from PubChem (CID 70275717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).