C24H26O3 — CID 172870864
3,5-bis[2-(4-methoxyphenyl)ethyl]phenol (PubChem CID 172870864) has the molecular formula C24H26O3 and a molecular weight of 362.47 g/mol. Its IUPAC name is 3,5-bis[2-(4-methoxyphenyl)ethyl]phenol.
| Compound Name | 3,5-bis[2-(4-methoxyphenyl)ethyl]phenol |
|---|---|
| PubChem CID | 172870864 |
| Molecular Formula | C24H26O3 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.19 |
| IUPAC Name | 3,5-bis[2-(4-methoxyphenyl)ethyl]phenol |
| SMILES | COc1ccc(CCc2cc(O)cc(CCc3ccc(OC)cc3)c2)cc1 |
| InChI | InChI=1S/C24H26O3/c1-26-23-11-7-18(8-12-23)3-5-20-15-21(17-22(25)16-20)6-4-19-9-13-24(27-2)14-10-19/h7-17,25H,3-6H2,1-2H3 |
| InChIKey | PRGYNAZBHZUCOD-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |