C30H30O4 — CID 172870463
4-[2-(4-hydroxyphenyl)ethyl]-2-[2-methoxy-5-[2-(4-methoxyphenyl)ethyl]phenyl]phenol (PubChem CID 172870463) has the molecular formula C30H30O4 and a molecular weight of 454.57 g/mol. Its IUPAC name is 4-[2-(4-hydroxyphenyl)ethyl]-2-[2-methoxy-5-[2-(4-methoxyphenyl)ethyl]phenyl]phenol.
| Compound Name | 4-[2-(4-hydroxyphenyl)ethyl]-2-[2-methoxy-5-[2-(4-methoxyphenyl)ethyl]phenyl]phenol |
|---|---|
| PubChem CID | 172870463 |
| Molecular Formula | C30H30O4 |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.21 |
| IUPAC Name | 4-[2-(4-hydroxyphenyl)ethyl]-2-[2-methoxy-5-[2-(4-methoxyphenyl)ethyl]phenyl]phenol |
| SMILES | COc1ccc(CCc2ccc(OC)c(-c3cc(CCc4ccc(O)cc4)ccc3O)c2)cc1 |
| InChI | InChI=1S/C30H30O4/c1-33-26-15-9-22(10-16-26)4-6-24-12-18-30(34-2)28(20-24)27-19-23(11-17-29(27)32)5-3-21-7-13-25(31)14-8-21/h7-20,31-32H,3-6H2,1-2H3 |
| InChIKey | KJZLKOINURKYCV-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |