C28H26O5 — CID 89034844
[4-[2-(3,5-dihydroxyphenyl)ethyl]phenyl] 2-(6-methoxynaphthalen-2-yl)propanoate (PubChem CID 89034844) has the molecular formula C28H26O5 and a molecular weight of 442.51 g/mol. Its IUPAC name is [4-[2-(3,5-dihydroxyphenyl)ethyl]phenyl] 2-(6-methoxynaphthalen-2-yl)propanoate.
| Compound Name | [4-[2-(3,5-dihydroxyphenyl)ethyl]phenyl] 2-(6-methoxynaphthalen-2-yl)propanoate |
|---|---|
| PubChem CID | 89034844 |
| Molecular Formula | C28H26O5 |
| Molecular Weight | 442.51 g/mol |
| Exact Mass | 442.18 |
| IUPAC Name | [4-[2-(3,5-dihydroxyphenyl)ethyl]phenyl] 2-(6-methoxynaphthalen-2-yl)propanoate |
| SMILES | COc1ccc2cc(C(C)C(=O)Oc3ccc(CCc4cc(O)cc(O)c4)cc3)ccc2c1 |
| InChI | InChI=1S/C28H26O5/c1-18(21-7-8-23-16-27(32-2)12-9-22(23)15-21)28(31)33-26-10-5-19(6-11-26)3-4-20-13-24(29)17-25(30)14-20/h5-18,29-30H,3-4H2,1-2H3 |
| InChIKey | WBDDCHGQLYVHCC-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.51 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|