C23H26NO4P — CID 4898785
[(benzylamino)-(4-hydroxy-3-methoxyphenyl)methyl]-(2-phenylethyl)phosphinic acid (PubChem CID 4898785) has the molecular formula C23H26NO4P and a molecular weight of 411.44 g/mol. Its IUPAC name is [(benzylamino)-(4-hydroxy-3-methoxyphenyl)methyl]-(2-phenylethyl)phosphinic acid.
| Compound Name | [(benzylamino)-(4-hydroxy-3-methoxyphenyl)methyl]-(2-phenylethyl)phosphinic acid |
|---|---|
| PubChem CID | 4898785 |
| Molecular Formula | C23H26NO4P |
| Molecular Weight | 411.44 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | [(benzylamino)-(4-hydroxy-3-methoxyphenyl)methyl]-(2-phenylethyl)phosphinic acid |
| SMILES | COc1cc(C(NCc2ccccc2)P(=O)(O)CCc2ccccc2)ccc1O |
| InChI | InChI=1S/C23H26NO4P/c1-28-22-16-20(12-13-21(22)25)23(24-17-19-10-6-3-7-11-19)29(26,27)15-14-18-8-4-2-5-9-18/h2-13,16,23-25H,14-15,17H2,1H3,(H,26,27) |
| InChIKey | WIKUPNJYLDBPDR-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.44 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|