C20H22NO5P — CID 71349459
acetic acid;[(benzylamino)-naphthalen-2-ylmethyl]phosphonic acid (PubChem CID 71349459) has the molecular formula C20H22NO5P and a molecular weight of 387.37 g/mol. Its IUPAC name is acetic acid;[(benzylamino)-naphthalen-2-ylmethyl]phosphonic acid.
| Compound Name | acetic acid;[(benzylamino)-naphthalen-2-ylmethyl]phosphonic acid |
|---|---|
| PubChem CID | 71349459 |
| Molecular Formula | C20H22NO5P |
| Molecular Weight | 387.37 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | acetic acid;[(benzylamino)-naphthalen-2-ylmethyl]phosphonic acid |
| SMILES | CC(=O)O.O=P(O)(O)C(NCc1ccccc1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C18H18NO3P.C2H4O2/c20-23(21,22)18(19-13-14-6-2-1-3-7-14)17-11-10-15-8-4-5-9-16(15)12-17;1-2(3)4/h1-12,18-19H,13H2,(H2,20,21,22);1H3,(H,3,4) |
| InChIKey | PAYNDKORRXTDCE-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.37 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|