C20H22NO3P — CID 42948663
[naphthalen-2-yl-(3-propan-2-ylanilino)methyl]phosphonic acid (PubChem CID 42948663) has the molecular formula C20H22NO3P and a molecular weight of 355.37 g/mol. Its IUPAC name is [naphthalen-2-yl-(3-propan-2-ylanilino)methyl]phosphonic acid.
| Compound Name | [naphthalen-2-yl-(3-propan-2-ylanilino)methyl]phosphonic acid |
|---|---|
| PubChem CID | 42948663 |
| Molecular Formula | C20H22NO3P |
| Molecular Weight | 355.37 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | [naphthalen-2-yl-(3-propan-2-ylanilino)methyl]phosphonic acid |
| SMILES | CC(C)c1cccc(NC(c2ccc3ccccc3c2)P(=O)(O)O)c1 |
| InChI | InChI=1S/C20H22NO3P/c1-14(2)16-8-5-9-19(13-16)21-20(25(22,23)24)18-11-10-15-6-3-4-7-17(15)12-18/h3-14,20-21H,1-2H3,(H2,22,23,24) |
| InChIKey | WGYLNLRIEHPSHQ-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.37 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|