C18H18NO3P — CID 25333600
[(S)-(3-methylanilino)-naphthalen-2-ylmethyl]phosphonic acid (PubChem CID 25333600) has the molecular formula C18H18NO3P and a molecular weight of 327.32 g/mol. Its IUPAC name is [(S)-(3-methylanilino)-naphthalen-2-ylmethyl]phosphonic acid.
| Compound Name | [(S)-(3-methylanilino)-naphthalen-2-ylmethyl]phosphonic acid |
|---|---|
| PubChem CID | 25333600 |
| Molecular Formula | C18H18NO3P |
| Molecular Weight | 327.32 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | [(S)-(3-methylanilino)-naphthalen-2-ylmethyl]phosphonic acid |
| SMILES | Cc1cccc(N[C@H](c2ccc3ccccc3c2)P(=O)(O)O)c1 |
| InChI | InChI=1S/C18H18NO3P/c1-13-5-4-8-17(11-13)19-18(23(20,21)22)16-10-9-14-6-2-3-7-15(14)12-16/h2-12,18-19H,1H3,(H2,20,21,22)/t18-/m0/s1 |
| InChIKey | KXCAYIGWYCCKRL-SFHVURJKSA-N |
| XLogP | 4.44 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.32 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|