C14H16NO4P — CID 71145120
(2-acetamido-2-naphthalen-2-ylethyl)phosphonic acid (PubChem CID 71145120) has the molecular formula C14H16NO4P and a molecular weight of 293.26 g/mol. Its IUPAC name is (2-acetamido-2-naphthalen-2-ylethyl)phosphonic acid.
| Compound Name | (2-acetamido-2-naphthalen-2-ylethyl)phosphonic acid |
|---|---|
| PubChem CID | 71145120 |
| Molecular Formula | C14H16NO4P |
| Molecular Weight | 293.26 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | (2-acetamido-2-naphthalen-2-ylethyl)phosphonic acid |
| SMILES | CC(=O)NC(CP(=O)(O)O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C14H16NO4P/c1-10(16)15-14(9-20(17,18)19)13-7-6-11-4-2-3-5-12(11)8-13/h2-8,14H,9H2,1H3,(H,15,16)(H2,17,18,19) |
| InChIKey | WPISPZBPIPXTCO-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.26 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|