C15H17FNO4P — CID 42950558
[(benzylamino)-(3-fluoro-4-methoxyphenyl)methyl]phosphonic acid (PubChem CID 42950558) has the molecular formula C15H17FNO4P and a molecular weight of 325.28 g/mol. Its IUPAC name is [(benzylamino)-(3-fluoro-4-methoxyphenyl)methyl]phosphonic acid.
| Compound Name | [(benzylamino)-(3-fluoro-4-methoxyphenyl)methyl]phosphonic acid |
|---|---|
| PubChem CID | 42950558 |
| Molecular Formula | C15H17FNO4P |
| Molecular Weight | 325.28 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | [(benzylamino)-(3-fluoro-4-methoxyphenyl)methyl]phosphonic acid |
| SMILES | COc1ccc(C(NCc2ccccc2)P(=O)(O)O)cc1F |
| InChI | InChI=1S/C15H17FNO4P/c1-21-14-8-7-12(9-13(14)16)15(22(18,19)20)17-10-11-5-3-2-4-6-11/h2-9,15,17H,10H2,1H3,(H2,18,19,20) |
| InChIKey | GSUCFPRHIVDNOZ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.28 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|